1. Calculate AH for the reaction:Use the following data:N₂ + O₂2NO2NO N₂ + 0₂2NO+ O₂ → 2NO₂Unit 7 - Worksheet 4: Hess's Law2. Calculate AH for the reaction:Use the following data:required!C(graphite) + O₂ → CO₂C(diamond) + O₂ → CO₂Use the following data:3. Calculate AH for the reaction:2 Al + 1/2O₂ → Al2O3N₂ + 20₂ >> 2NO₂2 Fe + 1½ 0₂ → Fe₂O3C(graphite) → C (diamond)2 Al + Fe₂O3 →2Fe +BatName:00 AH = +180 kJAH=-180kJ012Al₂O3ΔΗ = - 112 kJAH = - 394 kJAH = -395 kJAH = -1669 kJAH = -824 kJ

The thermochemical equations can be treated as algebraic equation which can be added, subtracted,…

1. Calculate AH for the reaction: Use the following data: N₂+O₂2NO 2NON₂ +0₂ Unit 7 - Worksheet 4: Hess's Law 2NO+ 0₂2NO2 2. Calculate AH for the reaction: Use the following data: C(graphite) + O₂ CO₂ C(diamond) + O₂ → CO₂ 3. Calculate AH for the reaction: N₂ + 202 → 2NO₂ C(graphite) → C (diamond) ΔΗ = + 180 kJ AH=-180kJ AH = - 112 kJ ΔΗ = - 394 kJ AH = -395 kJ

1. Calculate AH for the reaction: Use the following data: N₂+O₂2NO 2NON₂ +0₂ Unit 7 - Worksheet 4: Hess's Law 2NO+ 0₂2NO2 2. Calculate AH for the reaction: Use the following data: C(graphite) + O₂ CO₂ C(diamond) + O₂ → CO₂ 3. Calculate AH for the reaction: N₂ + 202 → 2NO₂ C(graphite) → C (diamond) ΔΗ = + 180 kJ AH=-180kJ AH = - 112 kJ ΔΗ = - 394 kJ AH = -395 kJ

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 68E: Consider the following reaction: N2(g)+3H2(g)2NH3(g) Calculate G for this reaction under the...

See similar textbooks

Similar questions

9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) , (c) HCI(g), (d) C6H12O6(s) , (e) NaF(s)
Use the appropriate tables to calculate H for (a) the reaction between copper(II) oxide and carbon monoxide to give copper metal and carbon dioxide. (b) the decomposition of one mole of methyl alcohol (CH3OH) to methane and oxygen gases.
How much heat is produced when 1.25 g of chromium meta’ reacts with oxygen gas under standard conditions?
Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?
The thermite reaction was once used to weld rails: 2Al(s)+Fe2O3(s)Al2O3(s)+2Fe(s)(a) Using heat of formation data, calculate H for this reaction. (b) Take the specific heats of Al2O3 and Fe to be 0.77 and 0.45 J/g C, respectively. Calculate the temperature to which the products of this reaction will be raised, starting at room temperature, by the heat given off in the reaction. (c) Will the reaction produce molten iron (mpFe=1535C,Hfus=270J/g)?
Although the gas used in an oxyacetylene torch (Figure 5.7) is essentially pure acetylene, the heat produced by combustion of one mole of acetylene in such a torch is likely not equal to the enthalpy of combustion of acetylene listed in Table 5.2. Considering the conditions for which the tabulated data are reported, suggest an explanation.
9.72 Although it can be a nuisance when a laptop computer freezes up and needs to be rebooted, we accept that as somewhat inevitable. But clearly the need to occasionally reboot the control system for the power grid would not be acceptable. Use the web to research ways that engineers ensure the reliability of crucial systems like the control infrastructure of the grid, and write a paragraph summarizing the main strategies employed.
Calculate H298 for the process Sb(s)+52Cl2(g)SbCl4(s) from the following information: Sb(s)+32Cl2(g)SbCl3(s)H298=314kJSbCl(s)+Cl2(g)SbCl5(g)H298=80kJ
9.56 Using heats of formation tabulated in Appendix E, calculate the heats of reaction for the following. (a) C2H2(g)+52O2(g)2CO2(g)+H2O(l) (b) PCl3(g)+Cl2(g)PCl5(g) (c) C2H4(g)+H2O(g)C2H5OH(g) (d) Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(l)
What mass of carbon monoxide must be burned to produce 175 kJ of heat under standard state conditions?
Consider the following reaction: N2(g)+3H2(g)2NH3(g) Calculate G for this reaction under the following conditions (assume an uncertainty of 1 in all quantities): a. T=298K,PN2=PH2=200atm,PNH3=50atm b. T=298K,PN2=200atm,PH2=600atm,PNH3=200atm