2. A chemist vaporizes, to a gas, a volatile liquid hydrocarbon (CHO) compound, containing carbon (C), hydrogen (H) and oxygen (O). The measured density (8) of the gas is 2.944 g/L at a temperature of 89.3°C and a pressure of 755.3 mmHg a) Calculate the molecular mass (MM) of the volatile hydrocarbon compound? b) When a 0.4136g sample of the volatile hydrocarbon is burned in oxygen, it produces: 0.8265 g of carbon dioxide (CO,); MM = 44.01 g/mol and 0.3383 g of water (H;O); MM = 18.02 g/mol are collected from the combustion, Data: 8 = T = P = mass of hydrocarbon sample = mass of CO, =. mass of H;O = Calculate: molecular mass (MM) of the volatile hydrocarbon compound_ g/mol mass of C = mol of C = mol mass of H = mol of H = mol mass of O =_ mol of O =. mol Determine: the empirical formula of the hydrocarbon compound (C,H,O, ) the molecular formula of the hydrocarbon compound (C̟H,O, )

2. A chemist vaporizes, to a gas, a volatile liquid hydrocarbon (CHO) compound, containing carbon (C), hydrogen (H) and oxygen (O). The measured density (8) of the gas is 2.944 g/L at a temperature of 89.3°C and a pressure of 755.3 mmHg a) Calculate the molecular mass (MM) of the volatile hydrocarbon compound? b) When a 0.4136g sample of the volatile hydrocarbon is burned in oxygen, it produces: 0.8265 g of carbon dioxide (CO,); MM = 44.01 g/mol and 0.3383 g of water (H;O); MM = 18.02 g/mol are collected from the combustion, Data: 8 = T = P = mass of hydrocarbon sample = mass of CO, =. mass of H;O = Calculate: molecular mass (MM) of the volatile hydrocarbon compound_ g/mol mass of C = mol of C = mol mass of H = mol of H = mol mass of O =_ mol of O =. mol Determine: the empirical formula of the hydrocarbon compound (C,H,O, ) the molecular formula of the hydrocarbon compound (C̟H,O, )

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter5: Gases

Section: Chapter Questions

Problem 165MP

See similar textbooks

Similar questions

Liquid oxygen was first prepared by heating potassium chlorate, KClO3, in a closed vessel to obtain oxygen at high pressure. The oxygen was cooled until it liquefied. 2KClO3(s)2KCl(s)+3O2(g) If 171 g of potassium chlorate reacts in a 2.70-L vessel, which was initially evacuated, what pressure of oxygen will be attained when the temperature is finally cooled to 25C? Use the preceding chemical equation and ignore the volume of solid product.
You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
62 Ammonium dinitramide (ADN), NH4N(NO2)2, was considered as a possible replacement for aluminium chloride as the oxidizer in the solid fuel booster rockets used to launch the space shuttle. When detonated by a spark, AND rapidly decomposes to produce a gaseous mixture of N2,O2, and H2O. (This is not a combustion reaction. The ADN is the only reactant.) The reaction releases a lot of heat, so the gases are initially formed at high temperature and pressure. The thrust of the rocket results mainly from the expansion of this gas mixture. Suppose a 2.3-kg sample of ADN is denoted and decomposes completely to give N2,O2, and H2O. If the resulting gas mixture expands until it reaches a temperature of 100°C and a pressure of 1.00 atm, what volume will it occupy? Is your answer consistent with the proposed use of ADN as a rocket fuel?
105 The decomposition of mercury(II) thiocyanate produces an odd brown snake-like mass that is so unusual the process was once used in fireworks displays. There are actually several reactions that take place when the solid Hg(SCN)2 is ignited: 2Hg(SCN)2(s)2HgS(s)+CS2(s)+C3N4(s)CS2(s)+3O2(g)CO2(g)+2SO2(g)2C3N4(s)3(CN)2(g)+N2(g)HgS(s)+O2(g)Hg(l)+SO2(g) A 42.4-g sample of Hg(SCN)2 is placed into a 2.4-L vessel at 21°C. The vessel also contains air at a pressure of 758 torr. The container is sealed and the mixture is ignited, causing the reaction sequence above to occur. Once the reaction is complete, the container is cooled back to the original temperature of 21°C. (a) Without doing numerical calculations, predict whether the final pressure in the vessel will be greater than, less than, or equal to the initial pressure. Explain your answer. (b) Calculate the final pressure and compare your result with your prediction. (Assume that the mole fraction of O2 in air is 0.21.)
Silane, SiH4, is the silicon analogue of methane, CH4. It is prepared industrially according to the following equations: Si(s)+3HC1(g)HSiCl3(l)+H2(g)4HSiCl3(l)SiH4(g)+3SiCl4(l) a. If 156 mL HSiCl3 (d = 1.34 g/mL) is isolated when 15.0 L HC1 at 10.0 atm and 35C is used, what is the percent yield of HSiCl3? b. When 156 mL HSiCl3 is heated, what volume of SiH4 at 10.0 atm and 35C will be obtained if the percent yield of the reaction is 93.1%?
Explain why the plot of PV for CO2 differs from that of an ideal gas.
Methanol (CH3OH) can be produced by the following reaction: CO(g)+2H2(g)CH3OH(g) Hydrogen at STP flows into a reactor at a rate of 16.0 L/min. Carbon monoxide at STP flows into the reactor at a rate of 25.0 L/min. If 5.30 g methanol is produced per minute, what is the percent yield of the reaction?
Pyruvic acid, HC3H3O3, is involved in cell metabolism. It can be assayed for (that is, the amount of it determined) by using a yeast enzyme. The enzyme makes the following reaction go to completion: HC3H3O3(aq)C2H4O(aq)+CO2(g) If a sample containing pyruvic acid gives 21.2 mL of carbon dioxide gas, CO2, at 349 mmHg and 30C, how many grams of pyruvic acid are there in the sample?
You have a 550.-mL tank of gas with a pressure of 1.56 atm at 24 C. You thought the gas was pure carbon monoxide gas, CO, but you later found it was contaminated by small quantities of gaseous CO2 and O2. Analysis shows that the tank pressure is 1.34 atm (at 24 C) if the CO2 is removed. Another experiment shows that 0.0870 g of O2 can be removed chemically. What are the masses of CO and CO2 in the tank, and what is the partial pressure of each of the three gases at 25 C?
A student prepares phosphorous acid, H3PO3, by reacting solid phosphorus triiodide with water. PI3(s)+3H2O(l)H3PO3(s)+3HI(g) The student needs to obtain 0.250 L of H3PO3(d=1.651g/cm3). The procedure calls for a 45.0% excess of water and a yield of 75.0%. How much phosphorus triiodide should be weighed out? What volume of water (d=1.651g/cm3) should be used?