A student does an experiment to determine the molar solubility of lead(II) bromide. She constructs a voltaic cell at 298 K consisting of 0.712 M lead nitrate solution and a lead electrode in the cathode compartment, and a saturated lead bromide solution and a lead electrode in the anode compartment. If the cell potential is measured to be 5.19x10-2 vV, what is the value of Ken for lead bromide at 298 K based on this experiment? Ksp for PbBr2

A student does an experiment to determine the molar solubility of lead(II) bromide. She constructs a voltaic cell at 298 K consisting of 0.712 M lead nitrate solution and a lead electrode in the cathode compartment, and a saturated lead bromide solution and a lead electrode in the anode compartment. If the cell potential is measured to be 5.19x10-2 vV, what is the value of Ken for lead bromide at 298 K based on this experiment? Ksp for PbBr2

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 89QAP: An electrolysis experiment is performed to determine the value of the Faraday constant (number of...

See similar textbooks

Similar questions

Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.