Calculate the standard free-energy change of the reaction catalysed by the enzyme phosphoglucomutase Glucose-1-P = Glucose-6-P, given that, starting with 28.26 mM Glucose-1-P and no Glucose-6-P, the final equilibrium mixture at 250C and pH=7.0 contains 9.12 mM Glucose-6-P and the remaining Glucose-1-P. Give the answer in J/mol.K to one decimal place.

Calculate the standard free-energy change of the reaction catalysed by the enzyme phosphoglucomutase Glucose-1-P = Glucose-6-P, given that, starting with 28.26 mM Glucose-1-P and no Glucose-6-P, the final equilibrium mixture at 250C and pH=7.0 contains 9.12 mM Glucose-6-P and the remaining Glucose-1-P. Give the answer in J/mol.K to one decimal place.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter23: Organic Polymers, Natural And Synthetic

Section: Chapter Questions

Problem 46QAP: Glycolysis is the process by which glucose is metabolized to lactic acid according to the equation...

See similar textbooks

Similar questions

Calculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0 °C. 4.74 x10¬3 M-1 eq In the rat hepatocyte, the physiological concentrations of glucose and P; are maintained at approximately 4.8 mM. What is the equilibrium concentration of glucose 6-phosphate (G6P) obtained by the direct phosphorylation of glucose by P;? 8.75 x10-8 [G6P] = M Incorrect
Calculate the equilibrium constant of the reaction in which glutamine is formed -O2CCH (NH3 +) CH2CH2CONH2 (hereinafter G) from glutamic acid -O2CCH (NH3 +) CH2CH2COOH (G ') in cells, under the action of the synthetase enzyme glutamine. This reaction is used to carry ammonia from the cells to the kidneys, where it is re-released and excreted. Use the value of the standard free reaction enthalpy G '(aq) + NH3 (aq) → G (aq) equal to +15.7 kJ / mol at 37 ° C. The reaction is driven by the feed-back of the ATP (aq) → reaction ADP (aq) + Pi (aq). the standard free enthalpy of which is -31 kJ / mol. What is constant equilibrium joint reaction: G '(aq) + NH3 (aq) + ATP (aq) → G (aq) + ADP (aq) + Pi (aq)?
A direct measurement of the standard free-energy change associated with the hydrolysis of ATP is technically very demanding because the minute amount of ATP remaining at equilibrium is difficult to measure accurately. However, the value of AG'o for ATP hydrolysis can be calculated indirectly, from the equilibrium constants of two other enzymatic reactions having less favourable equilibrium constants: Glucose-6-phosphate + H20 = glucose + Pi K'eg = 271 (1) ATP + glucose = ADP + glucose-6-phosphate K'eg = 889 (2) Use this information to determine the value for AG'o for the hydrolysis of ATP at 25°C. Justify the method used.
Calculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0 °C. K'eq = 4.74 x10-3 In the rat hepatocyte, the physiological concentrations of glucose and P₁ are maintained at approximately 4.8 mM. What is the equilibrium concentration of glucose 6-phosphate (G6P) obtained by the direct phosphorylation of glucose by P₁? [G6P]: 8.75 X10-8 M-1 Incorrect M
for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc
Calcium ions bind to a Ca2+-ATPase which has two identical calcium sites, in two stages with apparent equilibrium constants of K, = 3.5 x 105 and K2 = 2 x 106. Determinet for this binding.
Glucose-1-phosphate = glucose-6-phosphate AG'o = - 7.3 kJ mol-1 Glucose-6-phosphate = fructose-6-phosphate AG'O = + 1.7 kJ mol-1 Calculate the equilibrium constant, K'eg, for the conversion of glucose-1-phosphate to fructose-6-phosphate. You can use a value of RT = 2.48 kJ mol-1.
5. The protein unfolds at a transition temperature of 75 °C and the standard enthalpy of transition is 61 kJ mol-¹. Calculate the absolute molar entropy (S(353 K)) of the unfolded protein at 80°C, if Cp, folded = aT³ below 10K (a = 0.0257 J K²² mol-¹), above 10K Cp, folded = 5.23 J K-¹ mol-¹ and Cp, unfolded= 6.28 kJ K-¹ mol-¹,.
Which of the following statements are true and which arefalse? (a) For the reaction 2 A1g2 + B1g2 ∆ A2B1g2 Kcand Kp are numerically the same. (b) It is possible todistinguish Kc from Kp by comparing the units used toexpress the equilibrium constant. (c) For the equilibriumin (a), the value of Kc increases with increasing pressure.
For the triose phosphate catalyzed reaction: dihydroxyacetone phosphate <--> glyceraldehyde-3-phosphate the standard change in Gibbs free energy is ΔG'º=7.53 kJ/mol. Calculate the ΔG for this reaction at 298K when the concentration of dihydroxyacetone phosphate is 0.161 M and the concentration of glyceraldehyde-3-phosphate is 0.00163 M.
17.) A protein's enthalpy of denaturation (AH) at its denaturation temperature is 80.9 kcal/mol. The protein's Tm is 68 °C, and its AC, is 1650 cal/(mol K). (a) Calculate AS (Tm), ASd(37 °C) and AS (15 °C). (b) At what temperature is AS = 0?
The equilibrium constant Kc for the reaction fructose-1,6-diphosphate ⇋ glyceraldehyde-3-phosphate + dihydroxyacetone phosphate is 8.9 x 10-5 M at 250C and the behavior is assumed to be ideal?