Explain why the concentration of dissolved oxygen in freshwater is an important indicator of the quality of the water.

Q: Magnesium ions are removed in water treatment by the addition of slaked lime, Ca1OH22. Write a…

A: Presence of magnesium ions in water is responsible for the hardness of water. So, during water…

Q: Identify the molecule that is the source of oxygenatoms for O 2 production during photosynthesis.

A: Identify the molecule that is the source of oxygen atoms for O2 production during photosynthesis.

Q: Discuss the structure and function of ion channels and describe their importance in medicinal…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Write chemical equations for the following processes: (i) Chemical reaction for ΔH°f for mercury(I)…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: The number of moles of H2O produced in reaction of 50 mL 1.0 M HCl and 50 mL 1.0 M NaOH:…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: How would the increase in O3 in the late spring Antarctic stratosphere affect the concentration of…

A: The first step of the mechanism is affected by a change in ozone concentration, but there's no…

Q: What does it mean to say that mercury(II) halides are weak electrolytes?

A:

Q: How many grams of sodium carbonate is needed to prepare 3.0L of 0.10N solution? Atomic mass: Na…

A:

Q: What forms when the oxides of pollution react with water? O acid rain O carbon dioxide O kerogen

A: The sulphur oxides and nitrogen oxides are common oxides which causes pollution.

Q: The average daily mass of O2 taken up by sewage discharged in the United States is 59 g per person.…

A: One person depletes 59 g of oxygen, the mass of oxygen depleted (m) by 1,200,000 people is…

Q: Dissolved oxygen in water is essential for aquatic plants and animals but when the same water is fed…

A:

Q: How to get potassium hydroxide from potassium iodide? Give a detailed explanation of a process.

A: Potassium hydroxide is KOH.  Potassium Iodide is KI.   Reaction of KI  with hydrogen peroxide makes…

Q: Write the balanced equation for the neutralization reaction between H, SO, and KOH in aqueous…

A: When an acid reacts with a base it produces salt and water. Such reactions are known as acid-base…

Q: Write equations showing the stepwise ionization of phosphorous acid.

A:

Q: Water pollution is due to OA Industriol effuents OR Sewoge and other wastes OC Agricultural…

A: The release of substances into natural water bodies, which disturbs the aquatic ecosystem and makes…

Q: What is the precipitate formed from the reaction of permanent hard water with sodium carbonate?…

A: Permanent hardness of water is due to very soluble magnesium sulfate and slightly soluble calcium…

Q: 22. Which of these elements are the primary components in "hard water"? I. magnesium II. iron III.…

A: Here, we have to find the elements that are the primary components in "hard water".

Q: CaO(s) + CO2 (g) → CaCO3 (s) What mass of CO2 could be absorbed by 1.95 g of CaO? Mass = g CO2 What…

A:

Q: What is the expected electrical conductivity of the following solutions?(a) NaOH(aq)(b) HCl(aq)(c)…

A: A good electrolyte solution is when the substance dissolved in water to form its respective ions…

Q: Determine the mass concentration of N2 in the water at 20℃ when the water is in equilibrium with the…

A: Henry's Law A gas solubility in liquid in liquid is proportional to its pressure over the solution.…

Q: Suppose CaO is placed in a vacuum in which the partial pressure of oxygen is 10-r mm Hg. Will Cao be…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Write an equation to show the reaction between plaster of Paris and water.

A:

Q: how precipitation helps in extracting magnesium from sea water

A: Magnesium chloride is naturally extracted by seawater by precipitating it to magnesium hydroxide.…

Q: How many grams of lithium oxide must be carried on board to remove 80.0 kg of water?

A: Given, The amount of water = 80 Kg The chemical reaction of lithium oxide and water is; Li2O(s) +…

Q: What is the process to get potassium hydroxide from potassium iodide?

A: The concentration of ozone in ground level air gas react with potassium iodide KI in a redox…

Q: how many grams of oxygen are required to react with 10.0 g of C2H6

A:

Q: What mass of water can be produced from 10.0 g of hydrogen gas? O 10.0 g 18.0 g O 45.0 g 90.0 g None…

A: This problem can be solved via Stoichiometry and finding  out moles of Hydrogen .

Q: How many ammonia molecules must react to produce 1.25 kg of ammonium sulfate?

A: The formation of ammonium sulfate will take place when 2 moles of ammonia will react with 1 mole of…

Q: Heat is produced b. The concentration of the water increases c. The concentration of NaC2H3O2(aq)…

A: According to Le-chatlier principle if we disturb equilibrium by changing pressure,temperature, or…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Calculate the number of moles of H2O that will be produced by the reaction of 1.46 mole of solid…

A: Magnesium hydroxide reacts with hydrochloric acid to form magnesium chloride and water. The equation…

Q: You have dissolved 5 g of a rock containing a mixture of calcium carbonate and inert sand in 100 mL…

A: Mass of rock = 5g Volume of Solution = 100 mL = 0.1 L Molarity of solution = 1 mole /L Concentration…

Q: A 500 mL sample of waste water contains 15.72 ug of mercury, Hg. If the density of the sample is…

A: The volume of the wastewater sample is = 500 mL The amount of mercury in this sample is = 15.72…

Q: 13. Can a covalent compound like ethanol, CH3OH dissolve in water? Explain. sil 1slom

A: Yes, ethanol and methanol dissolve in water.

Q: What volume of CO2 measured at STP is produced when 23.5 g of CaCO3 is decomposed? CACO3 (s) →…

A: The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a…

Q: Write chemical equations for each of the following chemical and physical processes: (a)…

A: When an acid reacts with a base to form salt and water, known as neutralization reaction.

Q: >Describe what changes occur when atmospheric CO2 interacts with the world ocean ?

A: Dissolution of carbon dioxide in sea water results in the formation of methanol. The pH of ocean…

Q: Write the formula for a micelle of a sol of barium sulfate, obtained by the exchange reaction…

A: Micelle is a colloidal particle that is formed from the aggregation of many atoms, ions, or…

Q: Name the gas evolved : When dil. sulphuric acid reacts with sodium sulphite.

A:

Q: Instant cold packs utilize the formation of an aqueous solution of ammonium nitrate. A. Describe why…

A: “Since there are multiple questions and it is not mentioned that which one has to be solved so I am…

Q: when hydrated purple cobalt chloride, CoCl2 • 6H2O is heated, it is converted to blue anhydrous…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: What effect does an increase in the atmospheric carbon dioxide levels (and therefore rising…

A: Carbon dioxide is a green house gas.  The increased amount of atmospheric carbon dioxide level…

Q: what should be done to mitigate the impacts of ocean acidification on the Great Barrier Reef

A: Mitigation the impact of ocean acidification on the great barrier reef

Q: Calculate the saturation or equilibrium concentration (mg/L) of oxygen, nitrogen, and carbon dioxide…

A:

Q: Write chemical equations for each of the following chemical and physical processes: (a)…

A: A chemical equation represents the conversion of a reactant to the product. But the number of atoms…

Q: Give the important uses of sodium carbonate.

A: The inorganic compound that has the formula Na2CO3, which is white in color, and is water-soluble,…

Q: What mass of hydrogen gas results from the reaction of 8.5 g of KH with water?KH + H2 O ⟶ KOH + H2

A: Given data contains, Mass of KH is 8.5g. The chemical equation is, KH + H2 O ⟶ KOH + H2 The molar…

Group 15 elements

The elements of group 15 are phosphorus, nitrogen, bismuth antimony, and arsenic. The most abundant element which is present in the air is nitrogen and the percentage of nitrogen present in the air is 78%. In the free state, the elemental nitrogen is present as diatomic gas (N2). In the organic matter obtained from plants and animals, phosphorus is the dominant element present. In nucleic acids, phosphate groups are present. Phosphates are also found in teeth and bones. The other elements arsenic, bismuth, and antimony are found as sulfides. Arsenopyrite, bismuth glance, and stibnite are examples of sulfides of arsenic, bismuth, and antimony respectively.