Page <28>of 65Learning CheckConsider the following equation:3H,(g) + N,(g) → 2NH,(g)A. If you have 1 mol of H,, how many moles of N, are needed?B. If you have 0.5 mol N,, how many moles of NH, is made?C. If you have 2 mol NH3, how many moles of H, was used?VIC40S.67.RDKMCOB

Balanced chemical equation :- 3H2(g) + N2(g) -----> 2NH3(g) When 3 moles of H2 react with 1…

Answered: how many moles of N, are needed?

Science

Chemistry

how many moles of N, are needed?

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU4: Toxins: Stoichiometry, Solution Chemistry, And Acids And Bases

SectionU4.25: Mole Tunnel: Stoichiometry

Problem 2E

See similar textbooks

Related questions

Q: what is a definition of a mole

A: A mole corresponds to the mass of a substance that contains 6.023 x 1023 particles of the substance.…

Q: if you have a flask containing 15.6 mol of water, what is mass of the water in the flask?

A: The mole of water = 15.6 moles

Q: What is the molar mass of potassium permanganat

A: Molar mass is the sum of masses of each atom involved in the formation of the compound.

Q: What is the molar mass of unknown Q whose mass is 1.00g and .0350moles

A: Given data is as follows: The mass of the unknown Q = 1.00 g The moles of unknown Q = 0.0350 moles…

Q: The weight in grams of NaOH can be computed if the number of moles and the molar mass are given. O…

A: Using mole concept easily determines how much mole , molecular weight is used or formed in any…

Q: White limestones contains a large percentage of calcium carbonate, CaCO, What is the mass in grams…

A: The relation between mole and mass of any substance is given by - Mole = Mass/molar mass

Q: How many moles of Al(CN), are in 219 g of the compound?

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: How many molecules are in 22.4moles of CCI,?

Q: How many moles of MgSiO, are in 163 g of the compound?

A: Number of moles of a substance is equal to the mass of the substance divided by its molar mass.

Q: How many grams would be 4.87 mol of C,H,,?

A: Given :- number of moles of C5H12 = 4.87 To calculate :- mass of C5H12 (in g)

Q: at mass of AgK

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: How many grams of Br are in 145 g CaBr, ? mass:

Q: 2.4 grams of oxygen (molar mass = 16 grams per mole) would be how many moles?

A: Formula: Number of moles = given mass ÷ molecular mass Given data: mass = 2.4 g molecular mass (O2)…

Q: How are the molar mass and empirical formula mass for acompound related?

A: Empirical formula represents the simplest whole number ratio of elements present in a compound while…

Q: The percent by mass of calcium in CaI2 is ?????%.

Q: How many atoms are in 1 mol of atoms?

A: One mole of any atom contains 6.02214076 × 1023 of those atoms. The number 6.022 × 10²³ is known as…

Q: ny moles of HI will be formed?

Q: How many grams of iron(Il) chlorīde ! would be in 4.8 moles?

A: The molar mass of Iron (II) chloride is 126.75 g/mol

Q: n. What is the empirical formula?

Q: Determine the molar mass of Mn(CIO,),. molar mass: g/mol

A: Molar mass of Mn(ClO4)2 = ?

Q: How many moles c

Q: Six moles of hydrogen sulfide, H2S, would consist of how many molecule

A: Interpretation - To determine number of molecule of Six moles of hydrogen sulfide H2S -…

Q: what is the amount of moles?

A: Mole can be defined as standard unit for measuring large quantities of very small entities such as…

Q: What is the mole ratio of all the substances represented in this figure?

A: A mole ratio can be described as the ratio between the amounts in moles of the any two compounds…

Q: 17.5 moles of CO2 contain how many atoms of carbon?

A: Given, Number of moles of CO2 = 17.5 moles 1 mole of CO2 contains 6.023 × 1023 molecules of CO2 .

Q: What is the molar mass of oxygen?

A: To find the molecular mass of an oxygen molecule. Here, O2 means there are 2 oxygen atoms per 1…

Q: Calculate the number of g of O,

A: Given :- moles of C3H8 = 3.77 mol To calculate :- mass of O2 (in g)

Q: How many moles was that?

A: We supposed to answer one question at a time and post the remaining in the next submission.

Q: What’s mass of 6.75 moles of calcium nitrate?

A: The relationship between moles and mass of the substance is given by,

Q: What is the mass of 3.4 moles of FeBr, ?

A: In this question, the number of moles of FeBr2 is provided. The mass of FeBr2 has to be…

Q: grams of Zn(OH), will be formed in

Q: Percent yields are generally calculated from mass quantities.Would the result be the same if mole…

A: Interpretation- To explain with reason for the result of calculating percent yield using mole…

Q: What mass of KO, produces 235 g of 0,?

Q: How would I find the mass and moles of the solute?

A: Here, we have to explain how one can find the mass and moles of solute.

Q: Determine the molar mass of CH OCH,.

A: We know that, molar mass of C=12 g mol-1 Molar mass of O=16 g mol-1 Molar mass of H = 1 g mol-1

Q: What is the molar mass of Ca (PO,),?

A: Molar mass of any compound is that in which is contained number as Avogadro no.NA of that chemical…

Q: How many moles of Neon gas are there

A: Ideal Gas Law :- PV = nRT P is the pressure of gas V is the volume occupied by gas n is the…

Q: What is the molecular mass of this gas? =______ g/mol?

A: Volume = 530 cm3 Volume = 0.530 L Pressure = 145 kPa 1 kPa = 0.0099 atm 145 kPa =0.0099×145 atm…

Q: the moles of gl

Q: What is the value of one mole?

A: Mole is the SI unit to measure the number of atoms, molecules and ions of a particular entity.

Q: e quantity of moles of

Q: According to the following reaction, how many moles of calcium carbonate are necessary to form 0.434…

Q: ,how many moles of dichloromethane (CH,Cl) will be formed

A: Number of moles = mass/molar mass Molar mass of CH4 = 16.0425 g/mol

Q: c) How many moles of sulfur dioxide are formed?

Q: What is the molar mass of Aluminum ?

Q: How many grams of S are in 725 g of SO, ? mass:

A: Given Mass of SO2 = 725 gram Mass of Sulfur = ?

Q: 9) How many molecules of SO, are in 200 g of SO,?

Q: What is the molar mass of Au(PO,), ?

A: Definition of molar mass: The molar mass for any molecule can be calculated by adding the molar mass…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Page <
28
>
of 65
Learning Check
Consider the following equation:
3H,(g) + N,(g) → 2NH,(g)
A. If you have 1 mol of H,, how many moles of N, are needed?
B. If you have 0.5 mol N,, how many moles of NH, is made?
C. If you have 2 mol NH3, how many moles of H, was used?
VIC
40
S.
6
7.
R
D
K
M
CO
B

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
How many molecules of C2H4Cl2 can be prepared from 15C2H4 molecules and 8Cl2 molecules?
Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain this compound, calcium carbide is reacted with nitrogen at high temperatures. CaC2(s)+N2(g)CaNCN(s)+C(s) What mass of CaNCN can be produced if 7.50 mol of CaC2 reacts With 5.00 molOf N2 ?
Atoms of three different elements are represented by O, , and . Which compound is left over when three molecules of O. and three molecules of . react to form O. And O?
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
Which contains the greatest number of moles of oxygen atoms: 1 mol of ethanol (C2H5OH), 1 mol of formic acid (HCO2H), or 1 mol of water (H2O)? Explain why.
h Problems (student copy) + t/d/1DLVt75T41qQQOTzbdZ7baFNfwqfkKXsbq8OFVGtSMV8/edit?userid%=Datanner30@studentwps.org18 -Tanner ons Help Last edit was yesterday at 11:12 AM BIUA ====|三 E - E E ial 12 7 1 I LI2 I I a. II 4 ILI5 11 Na Sodium 22.990 Oxygen 15.999 1. 2 Na + O, ----> Na,O Mole Ratio Moles of A Moles of B Moles of B Moles of A Mole ratio Mass of A (in grama) 1 mole of A Molar mass of B Mass of B Molar mass of A mole of B (in grams) Moles of B Moles of A a) How many moles of sodium (Na) would be needed to react with 3.82 moles of oxygen (O2)? b) How many grams of Na20 can be produced from 156 grams of Na? hp
How many moles of H₂O form when 5.20 mol of C3H8 completely reacts? ..AL the
1. How many moles of iron(III) iodide, FeI3, are present in a sample that contains 3.23 moles of iodide ions? moles FeI3 2. How many moles of iodide ions are present in a sample that contains 4.19 moles of FeI3? .doc Submit Answer 4 R Boc 14 5 [Review Topics] [References] Use the References to access important values if needed for this question. moles I Retry Entire Group 2 T 6 T Y G FR B H 9 more group attempts remaining & 7 N AK U 8 1 M ( 9 K DD O L E P Previous Email Instructor A { + Next> Save and Exit Show All X
Acetylene (C,H,) gas and oxygen (0,) gas react to form carbon dioxide (CO,) gas and water (H,0) vapor. Suppose you have 11.0 mol of C,H, and 7.0 mol of O, in a reactor. O yes Could half the C,H, react? O no If you answered yes, calculate how many moles of co, would be produced. Round Imol your answer to the nearest 0.1 mol.
How many molecules of CH, are in these 5.00g? How many moles of Cl, are in 15.0 g of Cl,? How many molecules of Cl, are in these 15.0 g?
signment Score: 36.4% O Hint Check Answer Resources estion 14 of 26 Write the balanced equation for the complete combustion of methanol in oxygen. Do not include physical states or energy in the equation. For the alcohol, be sure to write the condensed formula. balanced chemical equation: