In condensed structural formulas, the amide group in an amide producedfrom a carboxylic acid and a primary amine can be written as -CO-NH-.Write the balanced chemical equation for the hydrolysis of N-methylpropanamide with HCI.HeatCH3-CH2-CO-NH-CH3 + H2O + HƠI — CH3-CH₂-COONH₂-CH3 + H3O++ CI™CH3-CH2-CO-NH-CH3 + HCICH3-CH2-CO-NH-CH3 + HCIHeatHeatCH3-CH2-CO-NH-CH3 + H2O + HƠICH3-CH2-CO-CH3 +CINH4CH3-CH₂-COOCI + NH3-CH3HeatCH3-CH2-COOH + CI+NH3-CH3 Give the IUPAC name for the following aromatic amide:3-chlorobenzanamide2-chlorobenzoic amide3-chlorobenzoic amideO 5-chlorobenzanamideO 1-chlorobenzanamideClONH₂

Amide underogo hydrolysis with dil HCl to form carboxylic acid and ammonium salt.

In condensed structural formulas, the amide group in an amide produced from a carboxylic acid and a primary amine can be written as -CO-NH-. Write the balanced chemical equation for the hydrolysis of N- methylpropanamide with HCI. CH3-CH2-CO-NH-CH3 + H2O + + CI™ CH3-CH2-CO-NH-CH3 + HCI + HCI CH3-CH2-CO-NH-CH3 + HCI Heat →→CH3-CH2-CO-CH3 + CI+NH4 Heat Heat Ỳ CH3-CH,-COONH2-CH3 + HJO* + CH3-CH2-CO-NH-CH3 + H2O + HCI CH3-CH₂-COOCI + NH3-CH3 Heat CH3-CH2-COOH + CI+ NH3-CH3

In condensed structural formulas, the amide group in an amide produced from a carboxylic acid and a primary amine can be written as -CO-NH-. Write the balanced chemical equation for the hydrolysis of N- methylpropanamide with HCI. CH3-CH2-CO-NH-CH3 + H2O + + CI™ CH3-CH2-CO-NH-CH3 + HCI + HCI CH3-CH2-CO-NH-CH3 + HCI Heat →→CH3-CH2-CO-CH3 + CI+NH4 Heat Heat Ỳ CH3-CH,-COONH2-CH3 + HJO* + CH3-CH2-CO-NH-CH3 + H2O + HCI CH3-CH₂-COOCI + NH3-CH3 Heat CH3-CH2-COOH + CI+ NH3-CH3

Introduction to General, Organic and Biochemistry

11th Edition

ISBN:9781285869759

Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Publisher:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Chapter16: Amines

Section: Chapter Questions

Problem 16.8P

See similar textbooks

Similar questions

18-28 Arrange these compounds in order of increasing acidity: benzoic acid, benzyl alcohol, phenol.
Give the IUPAC name for the following aromatic amide: NH, CI O 1-chlorobenzanamide O5-chlorobenzanamide O 2-chlorobenzoic amide O 3-chlorobenzoic amide O 3-chlorobenzanamide
Select the name for each amide. ye N-ethylpropanamide N-methylbutanamide N-butylethanamide N-ethylbutanamide 4-cyclopentylbutanamide 5-cyclopentylpentanamide O cyclopentylbutanamide butanamide cyclopentane N-butylethanamide N-diethylacetamide N,N-diethylethanamide N,N-dimethylacetamide N-ethyl.N-methylbenzoate ON-ethyl,N-methyl-2-phenylpropanamide N-ethyl-N-methyl-2-phenylethanamide N,N-diethylbenzoate
Draw the structure of the following three isomeric amides with chemical formula C6H11NO. Amide #1: (E)-N,N-dimethyl-2-butenamide Amide #2: (Z)-N-methyl-3-pentenamide Amide #3: (Z)-3-hexenamide
What is the naqe of the following benzene derivative? 1-acetate-1-chlorobenzene O 1,3-chlorocarboxylic benzene 5-chloroanaline O 5-chlorobenzoic acid O I-chlorobenzoie acid
Which of the following functional groups are present in 3-nitroaniline? Group of answer choices 1° amine amide para-disubstituted phenyl ketone 2° amine 3° amine aldehyde meta-disubstituted phenyl alkene nitro alcohol hydroxyl ortho-disubstituted phenyl ester alkyl ether
What steps would be used to synthesize an organic amine? Group of answer choices Ketone + oxidizing agent →carboxylic acid + ammonia →organic amine Alkene + acid → alcohol + ammonia →organic amine Ether + acid →ester + ammonia →organic amine Alkane + acid → alcohol + ammonia →organic amine Carboxylic acid + alcohol →ester + ammonia →organic amine Aldehyde + oxidizing agent →carboxylic acid + ammonia → organic amine
Name the following amide. N- N butyl N methyl butanamide N,N diethyl butanamide N ethyl N methyl butanamide O N,N dimethyl butanamide
Acid Anhydride Amine Thiol Peroxide Nitrile Arene
Draw the structure for the following compounds It organic 1: 2,2 diiodo-3-pentenoic acid 2: N,N-diethylpropanamide 3: 2-pentanone 4: phenoxy benzene 5: N,N-diethylpropanamide
Give the IUPAC name for the following acid amide: 0 CH3CH2CH(CH3)CH2CH(CH3)CH2C NH2
Oxytocin, sold under the trade name Pitocin, is a naturally occurring hormone used to stimulate uterine contractions and induce labor. Classify each amide in oxytocin as 1°, 2°, or 3°. NH2 H2N NH HN 'N H2N NH NH2 S oxytocin но IZ