The equilibrium constant, Kp, for the following reaction is 55.6 at 698 K: H₂(g) + 1₂(g) 2HI(g) Calculate the equilibrium partial pressures of all species when H₂ and 12, each at an intitial partial pressure of 1.45 atm, are introduced into an evacuated vessel at 698 K. P = H₂ P 12 P HI = Submit Answer atm atm atm Retry Entire Group 9 more group attempts remaining

The equilibrium constant, Kp, for the following reaction is 55.6 at 698 K: H₂(g) + 1₂(g) 2HI(g) Calculate the equilibrium partial pressures of all species when H₂ and 12, each at an intitial partial pressure of 1.45 atm, are introduced into an evacuated vessel at 698 K. P = H₂ P 12 P HI = Submit Answer atm atm atm Retry Entire Group 9 more group attempts remaining

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter12: Gaseous Chemical Equilibrium

Section: Chapter Questions

Problem 34QAP: At 500C, k for the for the formation of ammonia from nitrogen and hydrogen gases is 1.5105....

See similar textbooks

Similar questions

Hydrogen gas and iodine gas react to form hydrogen iodide. If 0.500 mol H2 and 1.00 mol I2 are placed in a closed 10.0-L vessel, what is the mole fraction of HI in the mixture when equilibrium is reached at 205C? Use data from Appendix C and any reasonable approximations to obtain K.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
Consider the following system at equilibrium at 25C: PCl3(g)+Cl(g)PCl5(g)G=92.50KJ What will happen to the ratio of partial pressure of PCl5 to partial pressure of PCI3 if the temperature is raised? Explain completely.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)
At 500C, k for the for the formation of ammonia from nitrogen and hydrogen gases is 1.5105. N2(g)+3H2(g)2NH3(g)Calculate the equilibrium partial pressure of hydrogen if the equilibrium partial pressures of ammonia and nitrogen are 0.015 atm and 1.2 atm, respectively.
Carbon dioxide decomposes into CO and O2 at elevated temperatures. What is the equilibrium partial pressure of oxygen in a sample at 1000 C for which the initial pressure of CO2 was 1.15 atm?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.