Using the following data, estimate the overall enthalpy of formation (in kJ/mol) for potassium chloride: K(s) + Cl₂(g) → KCI(s). Process Lattice energy of KCI lonization energy of K Electron affinity of Cl Bond dissociation energy of Cla Enthalpy of sublimation for K Change in Energy (AHº) -690 kJ/mol 419 kJ/mol -349 kJ/mol 239 kJ/mol 90 kJ/mol

Using the following data, estimate the overall enthalpy of formation (in kJ/mol) for potassium chloride: K(s) + Cl₂(g) → KCI(s). Process Lattice energy of KCI lonization energy of K Electron affinity of Cl Bond dissociation energy of Cla Enthalpy of sublimation for K Change in Energy (AHº) -690 kJ/mol 419 kJ/mol -349 kJ/mol 239 kJ/mol 90 kJ/mol

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter19: The Chemistry Of The Main-group Elements

Section: Chapter Questions

Problem 92QRT

See similar textbooks

Similar questions

Although nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (Nl3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s)+3IF(g)BF3(g)+NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction ( 307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) ( 96 kJ/mol), and BF3(g) ( 1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every l mole of BN. one of the by-products isolated is [IF2]+ [BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?
Given the following thermodynamic data, calculate the lattice energy of LiCl:ΔH°f[LiCl(s)] = -409 kJ/molΔH°sublimation [Li] = 161 kJ/molBond energy [Cl-Cl] = 243 kJ/molIE1 (Li) = 520 kJ/molEA1 (Cl) = -349 kJ/mol -1682 kJ/mol -984 kJ/mol -1560 kJ/mol -862 kJ/mol -1213 kJ/mol
Calculate the lattice energy of RbCl using the following data: AH (k) Rb(3) Rb(g) Chig) CI(g) + e Rb(s) + ¾Cl(g} Rb(g) Rb"(g) + e¯ 86 409 2CI(g) CF(g) RÜCI(s) 242 -355 435
Calculate the enthalpies of formation, AH;, of group 1 chloride compounds from their elements by using the Born- Haber cycle. Process ΔΗ, k/mol Sublimation of Li(s) 161 Sublimation of Cs(s) 78 Dissociation of Cl, (g) 244 Ionization energy of Li(g) 513 Ionization energy of Cs(g) 376 Electron affinity of Cl(g) -349 Lattice enthalpy of LiCl(s) 852 Lattice enthalpy of CsCl(s) 676 AH; of LiCl = kJ/mol AH; of CsCl = kJ/mol
Determine the second ionization energy of calcium (in kJ mol-1) from the given data (all in kJ mol-1): AH°[CaCl,(s)] = -796 AH¡[Ca(g)] = 178 AH°[CI(g)] = 122 First ionization energy of Ca(g) = 590 Electron affinity of Cl(g) = -349 Lattice enthalpy of CaCl,(s) = -2260 А 1150 В 1235 C 1093 D 1210
Calculate the standard enthalpy of formation of the M20(s) metal oxide (AH in kJ/mol) using the following data: Bond dissociation enthalpy of O2(g) = +498 kJ/mol First electron affinity of O = -141 kJ/mol Second electron affinity of O = +744 kJ/mol Enthalpy of sublimation of M = + 124 kJ/mol First ionization energy of M = + 372 kJ/mol Lattice enthalpy of M20(s) = -2115 kJ/mol Refer to the textbook for definitions of ionization energy and electron affinity. Do not use scientific notation for your answer. Do not enter units. Your Answer: Answer
Calculate the standard enthalpy of formation of the M20(s) metal oxide (AHe in kJ/mol) using the following data: Bond dissociation enthalpy of O2(g) = +498 kJ/mol First electron affinity of O = -141 kJ/mol Second electron affinity of O = +744 kJ/mol Enthalpy of sublimation of M = + 107 kJ/mol First ionization energy of M = + 488 kJ/mol Lattice enthalpy of M20(s) = -2108 kJ/mol
How can I use the Born Haber cycle to establish the lattice energy of CsCl (s)from the following data: ΔHf° [CsCl(s)] = -442.8 kJ/mol; enthalpy of sublimation of Cesium is 78.2 kJ/mol; enthalpy of dissociation of Cl2 (g) = 243 kJ/mol Cl2 ; IE1 for Cs(g) = 375.7 kJ/mol; electron affinity enthalpy-EA1 for Cl(g) = -349kJ/mol.
Calculate the second ionization energy of the metal M (AH¡on2 in kJ/mol) using the following data: Lattice enthalpy of MO(s), AH = -2278 kJ/mol Bond dissociation enthalpy of O2(g) = +498 kJ/mol %3D First electron affinity of O = -141 kJ/mol Second electron affinity of O = +744 kJ/mol Enthalpy of sublimation of M = + 125 kJ/mol First ionization energy of M = + 309 kJ/mol Standard enthalpy of formation of MO(s), AHf = -341 kJ/mol
Calculate the standard enthalpy of formation of the M2O(s) metal oxide (AH+ in kJ/mol) using the following data: Bond dissociation enthalpy of O2(g) = +498 kJ/mol First electron affinity of O = -141 kJ/mol Second electron affinity of O = +744 kJ/mol Enthalpy of sublimation of M + 116 kJ/mol First ionization energy of M = + 463 kJ/mol Lattice enthalpy of M₂O(s) = -2248 kJ/mol Refer to sections 9.4 and 9.5 in the textbook for definitions of ionization energy and electron affinity. Do not use scientific notation for your answer. Do not enter units. Your Answer:
Calculate the lattice energy,U (in kJ), of the fictitious compound, MCl2, given the following information: ΔHppt for MCl2 = 17.1 kJ/mol, ΔHhyd for M2+ = -450 kJ/mol, ΔHhyd for Cl- = -370 kJ/mol Your answer should have 4 sig figs.
Use the Born Haber cycle (show relevant steps) to determine the lattice energy of CsCl (s) from the following data: ΔHf°[CsCl(s)] = -442.8 kJ/mol; enthalpy of sublimation of Cesium is 78.2 kJ/mol; enthalpy of dissociation of Cl2 (g) = 243 kJ/mol Cl2 ; IE1 for Cs(g) = 375.7 kJ/mol; electron affinityenthalpy-EA1 for Cl(g) = -349kJ/mol.