What is the IUPAC name of the following compound? ball & stick +labels

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the IUPAC name for the following compound? HC

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)    Assign…

Q: .NH₂

A: For IUPAC naming following steps are required-> Start numbering from the side from which…

Q: What is the IUPAC name for the molecule shown?

A:

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation.

A: IUPAC NAME : 3-ethyl-2-methylpentane

Q: What is the correct IUPAC name for the compound shown here?

A: The given compound is  IUPAC Name of this compound has to be determined.

Q: What is the IUPAC name of the substance shown in the following model" ball & stick labels

A: Given,

Q: Give the IUPAC NAME of the following compound: (CH3)2C=CH2 Your answer

A:

Q: What is the IUPAC name of the substance shown in the following model? ball & stick, labels

A: Here first we choose long carbon chain containing double bond  We start numbering from double bond…

Q: What is the IUPAC name of the following compound? ball & stick v + labels

A: Before giving IUPAC name to any organic compound we must know rules for nomenclature. We should know…

Q: Give IUPAC names for the following compounds. ball & stick v |-+ labels 国

A: We have given the structure of organic compound and we have to give the IUPAC Name of the given…

Q: What is the IUPAC name for the following compound? NH₂

A:

Q: The IUPAC name of the compound below

A: Organic compounds are named according to the IUPAC nomenclature which has some general rules. The…

Q: Be sure to answer all parts. Give the IUPAC name for the following compound: HO. (select) (select)…

A:

Q: IUPAC name for the following compounds ?

A: The first step in nomenclature is to choose the longest carbon chain which should contain the…

Q: What is the IUPAC name for the following compound? HO

A: IUPAC name of the organic compound is composed of the following three components:Root name = depends…

Q: What is the correct IUPAC name for the compound below?

A: Given,

Q: What is the IUPAC name of the following substance? ball & stick v + labels

A:

Q: What is the IUPAC name of each of the following compounds? (d) (e) 스 (a) (b) (c)

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3.Please resubmit the question and…

Q: 3..Name the IUPAC for the following compound.

A:

Q: H.N CI

A: Given: An organic molecule,

Q: What is the correct IUPAC name for the compound shown?

A:

Q: What is the correct IUPAC name for the following compound? No capitalization, spacing or…

A:

Q: HO

A:

Q: What is the IUPAC name for the following molecule? CH3

A: Rules for naming cyclic organic compound is as follows; First, count the number of carbon atoms…

Q: What is the IUPAC name of the following compound? 0. он он

A:

Q: What is the proper IUPAC name for this compound

A: In the given compound, the carbonyl group gets the highest priority and lowest locant number and…

Q: What is the IUPAC name of the compound below?

A: The longest chain in the molecules consist of 7 C-atoms The molecule also has 3 methyl side chains…

Q: What is the IUPAC name for the compound? HO H3C

A: Cycloalkanes are monocyclic compounds. They are saturated hydrocarbons. They contain hydrogen and…

Q: What is the IUPAC name for the compound shown? No capitalization or italization.

A:

Q: What is the IUPAC name for the compound shown below?

A: First , Choose the longest carbon chain which has highest number of carbon ,then start  numbering to…

Q: odun What is the IUPAC name of the substance shown in the following model? ball & stick labels

A: Naming is done according to IUPAC nomenclature

Q: What is the IUPAC name of the following substance? ball & stick v labels

A:

Q: What is the IUPAC name for the compound shown below? он Он

A: The given compound contains 3 carbon atoms that are connected linearly and 2 –OH groups are…

Q: What is the IUPAC name of the following compound? gula HO. OH

A:

Q: What is the IUPAC name for the compound shown? OH HO IUPAC name:

A: The given compound contains three carbon atoms chain. Hence the IUPAC name of the compound is…

Q: What is the IUPAC name for the compound shown? IUPAC name:

A: The ring contains five carbon atoms, so it is a cyclopentane ring. In the ring, there are two methyl…

Q: What is the IUPAC name for the compound shown? Br H3C. CH3 IUPAC name:

A: During the IUPAC naming of a chemical compound, we have to remembered the main points are as given…

Q: What is the IUPAC name of the substance shown in the following model? ball & stick labels

A: Bond line structure of given problem-CH35-CH44-CH3=C2-CH31   Parent chain…

Q: What is the IUPAC name for the following compound? CI.

A: The iupac name is as follows:

Q: What is the IUPAC name of the following compound? 0:

A: • The given compound contains five carbon atoms in the ring. Therefore, the root word is 'pent'    •…

Q: What is the correct IUPAC name for CuMnO4?

A:

Q: What is the IUPAC name for the compound?

A: Alcohol is an organic compound having      -OH functional group and while doing IUPAC naming suffix…

Q: What is the IUPAC name of the following substance? ball & stick + labels >

A:

Q: What is the IUPAC name for the following compound?

A: The name of the compound contains  prefix + root word + suffix. Prefix indicates the substituent.…

Q: Write the correct IUPAC name of product

A: IUPAC name of the product will be related to benzene as the product is a benzene ring substituted…

Q: IZ What is the IUPAC name for the compound shown? CH3 H3C The IUPAC name is:

A:

Q: Using E/Z prefixes as appropriate, give the IUPAC name for each of the following compounds Please…

A: If both the highest priority groups are on the same side then it is a Z-alkene i.e. cis  If both the…

Q: IUPAC name

A:

Q: b) 'N'

A: It is clear that this structure is an amine as it contains an N atom. It has N atom at centre to…