What is the oxidation number of the central metal ion in each of the following complexes or compounds?A. NiF, BraB. [Cr(H20)2 (NH3)4C. Na Cu(CN)»]13+Express the oxidation numbers numerically, in the order that the complexes are listed, separated by commas. Fora nonzero oxidation number, be sure to include the sign (e.g., +1,-2,+3).

Answered: Image /qna-images/answer/4f31b2ae-5459-4309-bd84-12fa80a14404.jpg

Answered: What is the oxidation number of the…

What is the oxidation number of the central metal ion in each of the following complexes or compounds? A. NiF,Bra] B. [Cr(H2O)2 (NH3)4* C. Na[Cu(CN)2] 13+

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 52QAP: A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600...

See similar textbooks

Related questions

Q: Which of the following reagent provides more than one pair of electrons for metal ions to form a…

Q: Which one of the following complex ions has geometric isomers? [Fe(NH3);CI]2+ [Zn(NH3)4(en)]²+…

A: Complex having type [M(A)4B2] OR [M(AB)2C4] show geometrical isomers is not of [M(A)4B2] OR…

Q: In the di-cationic complex (+2) shown below, how many electrons around the metal center can be…

Q: The following is a series of complex compounds whose central atom is a transition metal ion that has…

Q: What is the coordination number for each of the following complexes or compounds? A. [Fe(gly)2…

A: Total number of points of attachments to Central metal atom is known as coordination number.…

Q: /hich of the following complex ions absorbs light of the shortest wavelength? A) [Crl6]3- B)…

Q: Which of the following compounds is expected to have the lowest K₂ (complex dissociation constant)?…

A: A multiple choice question based on coordination complexes that is to be accomplished.

Q: The following ligands that can form complex compounds with class b metals are the most stable…

Q: An example of a coordination compound is [IrCIBr(en)2]Br. What is the oxidation state of the iridium…

Q: 5.16 Classify the following complex ions as inert or labile: (a) [Ru(NH3)5py]3+ (b) [Cr(acac)3] (c)…

A: The metal ion having d electron 0,1,2,7,8,9 electron are labile. The metal ion having d electron…

Q: Give formulas for the following complex ions. tetracarbonyldihydroxochromium(III) ion

A: Given, The formula of tetracarbonyldihydroxochromium(III) ion is:

Q: In the preparation of some of the solutions of metal complexes, what is done to ensure that the…

A: In several metal complexes the central metal atoms are oxidised and most of them have charge on the…

Q: Consider the complex ion [Co(en)2(SCN)Cl]+ (a) identify the ligands and their charges (b)…

A: Ligands are those species that bind with Central metal atom to form a coordination complex.…

Q: Name the following complex ions. formula Mn Br [Co (CN),] [Cr(CO₂)₂] name X S ?

A: Name the given complexes ---

Q: 9. Count the electrons in the following complexes and determine the oxidation state of the metal. a.…

A: Organometallic is branch of chemistry in which we deal with metal carbon bond.

Q: Transition metals are complexes that act as? Select one: a. Anions O b. Lewis acid O c. Neutral O d.…

A: Transition metals have partially filled d orbitals(d1-9 ), so most of them possesses vacand d…

Q: Which of the following will react with transition metals to form complex ions in which the ligand is…

A: Bidentate ligand have two donor atoms which allow them to bind to a central metal atom at a two…

Q: A chemist synthesizes two coordination compounds. One compound decomposes at 280°C, the other at…

Q: Which of the following complex ions has distorted octahedral geometry, with two elongated bonds? O…

A: Jahn-Teller distortion- Geometric distortion of non-linear molecular and reduction in energy and…

Q: For complexes of the same metal ion with no change in oxidation number, the stability increases as…

A: It’s explained as given below:

Q: R CH, CHa NH H,C NH CH, CH, HN CHa "CHa HC он

A: This structure is of Coenzyme Vit B12. Vitamin B12 is the most chemically complex of all the…

Q: What is crystal field theory?Briefly discuss the colors of transmission Metal Complexes.

A: The Crystal Field Theory (CFT) is a model for the bonding interaction between transition metals and…

Q: 1. The complexes ions of [Cu(H20)6]²+ and [Cu(NH3)4]2+ appear a pale shade of blue and a darker…

A: At the point when ligands append to a transition metal to shape a coordination complex, electrons in…

Q: Which one of the following statements is correct about the complex [Cr(NH3).Cl] A It has an…

A: Given complex is, [Cr(NH3)4 Cl2]-

Q: Which of the following will react with transition metals to form complex ions in which the ligand is…

A: Ligand: Atoms or molecule having lone pair or negative charge that it donate to metal ion to form…

Q: For which complex ion are the correct coordination number, the oxidation number of the metal, and…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 1. What is the coordination number of the central metal atom? 2. What formula should appear inside…

A: Given, amminechlorobisethylenediaminechromiumIIIsulfateRequired,…

Q: Which of the following pairs of complex ions are examples of linkage isomers? [Fe(CO)5NO2]2+ and…

A: We have to choose the following given pairs of complex ions are examples of linkage isomers among…

Q: In 2001, chemists at SUNY-Stony Brook succeeded in syn-thesizing the complex trans-[Fe(CN)4(CO)2]2-,…

A: Oxidation state of CN- = -1 Oxidation state of CO = 0 Calculation of oxidation state of Fe in the…

Q: Q5 a) What are the geometric shape and the oxidation number of the copper atom, respectively, for…

A: We are given a complex of copper i.e [CuCl5]3-

Q: The octahedral complex ions [FeCl6]3- and [Fe(CN)6]3- are both paramagnetic, but the former is high…

A: Both the octahedral complex ions [FeCl6]3- and [Fe(CN)63- have Fe in +3 oxidation state. The number…

Q: Write the names of [Co(NH3)4CO3]NO3 . Write the name of the counter ion . What kind of isomerism…

A: Given formula, [Co(NH3)4CO3]NO3 Counter ion is the anion or cation present outside the square…

Q: 13. In which of the following complex ions is th ligand bidentate? A Cu EDTAP B (Co(C:O.)} C [Fe(CN)…

A: The question is based on the concept of coordination chemistry. it talks about ligand chemistry. we…

Q: Name or Give the formula following COMPLEX-IONS of a. Ni(H2O)6^+2 b. Zn(OH)4^‒2

Q: 19. Which complex has the greatest number of unpaired electrons? A. [CuCla]²- B. [CrF6]3- C.…

A: Transition metals/d block metals have variable oxidation states . They can form coordination…

Q: Name the following complex ions. formula name [MnBr. * [Cu(co),] tricarbonylcopper(I)

A: Metal complexes are formed by generally d block metal and legands which donates them electrons.

Q: A complex is written as NiBr2 . 6 NH3. What is the oxidation state of the Ni atom in this complex?

A: The given compound is [Ni(NH3)6]Br2 Oxidation number is the total number of electrons an atom loses…

Q: For the following transition metal complexes match the complex with its corresponding number of d…

A: The electronic configuration with the corresponding number of d electrons and low spin / high spin…

Q: Which of the following colorful octahedral complex solutions should have the longest Amax? Mn(CO)62…

Q: Given the complex, [Rh(en)2(NO2)2]NO2 1) Name it. 2) What is the oxidation state of the metal? 3)…

A: We have find out complex name, oxidation state of metal and coordination number of central metal…

Q: Predict which complex is colorless: [Cr(en)3]2+, [Fe(CN)6]3−, [Zn(CN)4]2−, [Ni(CN)2Br2]2−?

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: 45. Which complex has the weakest carbon-oxygen bond due to backbonding? (A) [Ti(CO), (B) CrCO) (C)…

A: Which complex has the weakest carbon - oxygen bond due to back bonding ?

Q: 10) What is a representative orbital-filling diagram for the cobalt ion in the low spin complex of…

Q: Consider the complex ion [Co(en)2(SCN)Cl]+ a. Identify the ligands and their charges. b. What is the…

A: The complex is [Co(en)2(SCN)Cl]+ . a. Ligands : 1. en (ethylenediamine) , Charge is 0. 2.SCN…

Q: The tetrahedral [Col4]²¯ and square planar [PdBr4]2- complex ions are respectivel.. а. both high…

A: 1) We know that I- and Br- both are weak field ligands so for tetrahedral [CoI4]2- the splitting…

Q: Which of the following octahedral complex ions will havethe fewest number of unpaired electrons?(a)…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Which complex ion is formed when undecomposed AgBr is washed with hypo solution in photography?

A: Sodium thiosulfate solution is used for the processing of photographic and film. It is also known as…

Q: 7. How d electrons are in each metal of the following complexes? Give the oxidation number of many…

Q: Complexes 1. What is the coordination number and oxidation number of the central metal in each of…

A: The coordination number and oxidation number of the central metal is:

Q: Which of the following complex ions is Paramagnetic (has unpaired electrons)? Explain. a) weak…

A: Weak field complex has low CFSE value of ligands. Therefore inner orbitals electrons are not paired.…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

What is the oxidation number of the central metal ion in each of the following complexes or compounds?
A. NiF, Bra
B. [Cr(H20)2 (NH3)4
C. Na Cu(CN)»]
13+
Express the oxidation numbers numerically, in the order that the complexes are listed, separated by commas. For
a nonzero oxidation number, be sure to include the sign (e.g., +1,-2,+3).

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
The standard reduction potential for the reaction [Co( H 2 O)6]3+(aq)+e[CO( H 2 O)6]2+(aq) is about 1.8 V. The reduction potential for the reaction [Co( NH 3 )6]3+(aq)+e[Co( NH 3 )6]2+(aq) is +0.1 V. Calculate the cell potentials to show whether the complex ions,. [Co( H 2 O)6]2+ and or [Co( NH 3 )6]2+, can be oxidized to the corresponding Cobalt (III) complex by oxygen.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
Ethylenediaminetetraacetate (EDTA4 ) is used as a complexing agent in chemical analysis with the structure shown in Fig. 21.7. Solutions of EDTA4 are used to treat heavy metal poisoning by removing the heavy metal in the form of a soluble complex ion. The complex ion virtually prevents the heavy metal ions from reacting with biochemical systems. The reaction of EDTA4 with Pb2+ is Pb2+(aq) + EDTA4(aq) iPbEDTA2(aq) K = 1.1 1018 Consider a solution with 0.010 mol of Pb(NO3)? added to 1.0 L of an aqueous solution buffered at pH = 13.00 and containing 0.050 M Na1EDTA. Does Pb(OH)2 precipitate from this solution? [Ksp for Pb(OH)2 = 1.2 1015.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?