Answered: What is the structure of propofol,…

What is the structure of propofol, which has the IUPAC name 2,6-diisopropylphenol? Propofol is an intravenous medication used to induce and maintain anesthesia.

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter13: Alcohols, Phenols, And Ethers

Section: Chapter Questions

Problem 13.38E

See similar textbooks

Related questions

Q: What is the correct IUPAC name for the alcohol shown here? A) dimethylpentanol B)…

A: This question belong to Nomenclature of organic compound. In this question, there are two option B),…

Q: Draw the structures for the four carboxylic acids of molecular formula C 5H 10O 2. Give the IUPAC…

A: Carboxylic acid: These are the organic acid with general formula of R-COOH, It contains carboxyl…

Q: Draw the molecule that corresponds to each IUPAC name. (a) (S)-hexan-3-amine; (b)…

A: (a)

Q: The correct IUPAC name of the following compound is: Но O a. 1,7-oxo-1-octanol O b.…

Q: Which compound has the highest boiling point? A. methoxyethane B. trimethylamine C. ethylmethylamine…

Q: Define Phenol–Formaldehyde .

A: Phenol is a chemical compound with an aromatic ring and -OH group attached to it. Formaldehyde is…

Q: What products are formed when an alcohol undergoes dehydration?

Q: NH2 The IUPAC name of is: Br (a) 4-Bromo benzenamine (b) 4-Amino-1-bromobenzene (c) 4-Bromo…

Q: Autooxidation of Benzaldehyde?

Q: Draw a structure to correspond to each of the following names. a) Methyl-2-propanol b) Diphenyl…

A: a) Methyl-2-propanol name is ambiguous. So, let us consider the name of given compound as…

Q: ОН HO HO

Q: What intermolecular forces are present when 1-butanol is mixed with water?

A: Hydrogen bonding is present when 1-butanol is mixed with water. But ether only has weak dipole…

Q: Draw the structure for each of the following: a. 2-bromo-4-iodophenol b.…

A: a). The name of the compound is 2-bromo-4-iodophenol, which shows that bromine and iodine atoms are…

Q: what are the structures for the dollowing written out compltetly b) hexonoate reacts with methyl…

Q: What is the correct IUPAC name for the compound shown here? A) 2-butanol B) 3-butanol C) 2-pentanol…

Q: What is a ketone with two functional groups and no fewer than 6 carbon atoms and has a medical…

A: This question is from biochemistry. Drugs which are used for medical purpose are all chemical…

Q: Which among the following is formed when alcohol is dehydrated? A. Aldehyde B. Ketone C. Alkene…

A: Dehydration means the removal of water molecule.

Q: 9. What is the IUPAC of the following compound? (CH3CH2)3COH a) 2-Ethyl-2-pentanol b)…

A: Given,

Q: What is the correct IUPAC name for the compound shown here? A) 2-methyl-3-propanol B) propanal C)…

A: Alcohols contain hydroxyl (OH) functional group.

Q: Draw the molecule that corresponds to each IUPAC name. (a) 3,3-dipropoxypentan-1-amine; (b)…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: Give the IUPAC name for the following compound. a) ethyl propanoate b) ethyl propyl ester c) ethyl…

Q: what does 4-phenylcyclohexanol and 4-phenylcyclohexanone?

A: To write the structure of 4 -phenyl cyclo hexanol and 4 - phenylcyclohexanone.,

Q: What is the line structure and structural formula of 2-hydroxy-3-methoxy-1-hexanal?

A: Given :- IUPAC name = 2-hydroxy-3-methoxy-1-hexanal To draw :- Its line structure and structural…

Q: give the structure corresponding to each IUPAC name 1. 6,6-diethyl-4-nonanol

A: The IUPAC system provides a basic system that helps in the naming of organic compounds. The…

Q: The characteristic odor of fish is due to a mixture of alkylamines. Discuss about the alkylamines…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: What is the IUPAC name of the following compound? он O cis-4-ethylcyclohexanol O…

Q: What is the IUPAC name of the following compound? H. (S)-3,4,4-trimethylpentanal O…

A: IUPAC nomenclature is used for naming of chemical organic compounds.

Q: . Based on the general IUPAC rules, which one of the following structures is 3-hydroxypropanal? он…

A: IUPAC stands for International Union for Pure and Applied Chemistry

Q: The IUPAC name for the following compound is: CH3-CH 2-CH a) acetaldehyde b) 1-ethanal c) propanal…

A: All chemical compounds can be named with certain rules which are purposed by IUPAC. It purposed to…

Q: distilled water compound and Diethyl ether compound

A: Answer : water- 1) molecular weight of water is 18 g/ mol 2) oxygen is connected with two hydrogen…

Q: Sulfur functional groups are often important in biological pathways. Consider the naming and…

A: Nomenclature:

Q: The common name of 1,2-ethanediol is ____________. a. ethanol b. antifreeze c.…

A: 1,2-ethanediol is a alcohol which has two -OH group. It is also know as ethylene glycol. It's…

Q: What is the IUPAC name of the following molecule? 2-methyl-3-butanone 2-keto-3-methylbutane…

A: The molecule contains ketone and methyl groups as functional groups. The first priority is given to…

Q: 1. Write the correct IUPAC names for the following organic compounds: a) b) c) CI d)

Q: Acetominophen is a widely used and an effective pain reliever. Identify the functional group circle…

Q: what is the structure of a)butanol b) 2-propanol c) 2 methyl-2 propanol d) 2 methylbutanol

A: The compounds given are, a) Butanol b) 2-propanol c) 2 methyl-2-propanol d) 2-methybutanol.

Q: Give the IUPAC name for the organic compound formed when 1-propanol is dehydrated in the presence of…

A: Dehydration of alcohol is done with concentrated sulphuric acid in high temperature.

Q: HO OCH3 но ОН A В ОН HO ОН РО D E

A: ->Hemiacetal is when one OH and one H , one OR is present at same carbon ->Acetal is when no…

Q: 1. Write the correct IUPAC names for the following organic compounds: a) b) c) CI

A: The given compounds have been named according to the rules set by the IUPAC by considering the…

Q: Does Phenols react with NaHCO3? Why or why not?

A: Phenols are more acidic than alcohols but less acidic than carboxylic acids.

Q: Draw a structure for each of the 2-ethyl-4-iodoaniline:

A: The given name is 2-ethyl-4-iodoaniline.

Q: The IUPAC name for the compound CH3-CH(CH3)-CH2-CH(NH2)-CH3 is a) 2-methylpentanamine

A: Rules for writing the IUPAC name, Prefix represents the substituent present in the molecule and its…

Q: Give acceptable names for two ketones ?

A: Solution- 2-Methylpentan-3-one IUPAC naming of the given compound is correct because as we know…

Q: the following, which compound has the highest boiling point? a. Hexanoic acid b. 1-Hexanol c.…

Q: Draw the hydrogen bonding that takes place between(a) two molecules of ethanol.(b) two molecules of…

Question

What is the structure of propofol, which has the IUPAC name 2,6-diisopropylphenol? Propofol is an intravenous medication used to induce and maintain anesthesia.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

General Physical Properties of Organic Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

List the following compounds in order of increasing water solubility: a.ethoxyethane b.propanoic acid c.pentane d.1 butanol
What are hemiacetals and acetals, and how are they prepared?
What is the IUPAC name of a benzene ring with an amine group (NH2-) attached at carbon 1 and a bromine attached at carbon 2? O 2-bromoaniline O 2-bomotoluene O 2-bromobenzene O 2-bromophenol
What is the molecular formula for 1-propanol?
Alcohols contain which functional group? amine thiol amide hydroxyl
what is the chemical formula of Sodium Benzoate
Select the IUPAC name for the compound. `NH2 The IUPAC name is: 2-methyl-3-propanamine or 2-methylpropan-3-amine 2-methyl-1-propanamine or 2-methylpropan-1-amine 2-methylpropanamine 2,2-dimethyl-1-ethanamine or 2,2-dimethylethan-1-amine
The common name used for hydroxybenzene.
Explain why benzophenone is solid at room temperature, and why cyclohexanone is liquid at room temperature.
What is the IUPAC name for CH3CH2CH2CH2OHCH3CH2CH2CH2OH? 5-pentanal pentanal 3-butanol 1-butanol 5-pentanol 1-pentanol
What is an acetal?
Why are ethers used as inhalation in general anesthetics? Describe why we do no use diethyl ether as a general inhalation anesthetics anymore? What are we using today as general inhalation anesthetics? Are there draw backs to modern day inhalation as the anesthetics?