Which statement is false regarding the accurate determination of pH? The electrode should be selective for protons. Comparison of the test solution to reference standards is necessary. The electrode should be insensitive to cations such as Na' and K'. The electrode should be glass. The electrode directly measures the hydrogen ion concentration of the test solution.

Which statement is false regarding the accurate determination of pH? The electrode should be selective for protons. Comparison of the test solution to reference standards is necessary. The electrode should be insensitive to cations such as Na' and K'. The electrode should be glass. The electrode directly measures the hydrogen ion concentration of the test solution.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 77AP

See similar textbooks

Similar questions

Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)