Q: Why an anhydride is less reactive than an acyl chloride?
A: The reactivity of acyl chloride and acid anhydride occurs due to the electrophilicity of carbonyl…
Q: Why is only one amide obtained from the reaction of acetyl chloride with an equivalent of…
A: When acetyl chloride reacts with amine then amine act as nucleophile and attacks on carbonyl carbon…
Q: I have questions about p-nitroaniline: Why we are not starting from aniline but from acetanilide…
A: Reference: Self Introduction: Amino group shows very high reactivity towards a wide variety of…
Q: Why aryl bromide is a bad starting material for an electrophilic aromatic substitution? What is…
A: For electrophilic aromatic substitution ,the phenyl ring should be electronically enriched as…
Q: Why the reaction of phenol and ICl does not yield 4-chlorophenol but 4-iodophenol only?
A: Generally, phenol is acidic due to the presence of partial positive charge on O atom due to…
Q: benzoic acid is synthesized from benzene suggest a synthetic route from benzin to benzoic acid with…
A: Benzoic acid can be prepared from the benzene with the help of the Friedel-Craft reaction. In the…
Q: Why does benozic acid dissolve in toulene but not hexane?
A: Benzoic acid dissolve in toluene, but it does not dissolve in hexane.
Q: Explain the general procedure for the laboratory preparation of the synthesis of Aniline from…
A: We have to Explain the general procedure for the laboratory preparation of the synthesis of Aniline…
Q: Explain why the reaction of an alkyl halide with ammonia gives a low yield of primary amine.
A: Since after the first step of the reaction, we get a C attached to the N in the molecule as shown in…
Q: Give Reasons for the following: Aniline does not undergo Friedel-Crafts reaction. þ methylaniline…
A: (1) Aniline does not undergo Friedel-Crafts reaction.A Friedel-Crafts reaction is carried out in…
Q: Explain why quick formation of a white precipitate upon treating a compound with saturated sodium…
A: Reactant primary alkyl chloride or primary alkyl bromide Reagent saturated sodium iodide in acetone…
Q: Why an anhydride is more reactive than a carboxylic acid?
A: There are many carboxylic acid derivatives present and acid anhydride is now of those derivates. The…
Q: Why are the starting materials (Triphenyl Phosphine and Benzyl Chloride) soluble in xylene but the…
A: According to the solubility rule, like dissolve like , polar/ionic solvents dissolve polar/ionic…
Q: Explain how you would test the relative reactivities of 1‐butanol vs. 2‐butanol in a nucleophilic…
A: relative reactivities of 1‐butanol vs. 2‐butanol in a nucleophilic substitution with sodium bromide…
Q: What happens if water is added during the Methyl Benzoate nitration? Why is methyl m-nitrobenzoate…
A:
Q: Write mechanisms for the reactions of aniline with acetyl chloride and with acetic acid, to give…
A:
Q: why is it necessary to cool the acidic exact of aniline in ice before adding solid sodium hydroxide?
A: The addition of NaOH to an acidic extract of aniline is a step of acid-base extraction which is a…
Q: Compare the reactivity of following compounds for coupling reactions Phenol, p-nitro aniline,…
A: An azo coupling reaction involves reaction between a diazonium compound and any other aromatic…
Q: why it is not a good idea to use dichloromethane as a solvent in Grignard reactions.
A: Reason for not using dichloromethane as a solvent in Grignard reactions.
Q: Discuss all the principles that can be used to facilitate acylation reactions. b) Why do aldehydes…
A: (a) Answer - According to the question - Given - Acylation is the process of adding an acyl group…
Q: why is acetic acid added after homogenization in extraction and isolation
A: A question based on analytical separation that is to be accomplished.
Q: f 1-phenylazo-2-naphthol (or Sudan I), phenyldiazonium reacts with β-naphthol. Draw the resonance…
A:
Q: Give the identity of the nucleophile in the two Grignard reactions of: phenylmagnesium bromide and…
A:
Q: What is the role of an acid catalyst in nucleophilic addition of aldehydes and ketone?
A:
Q: Why is the para substituted derivative formed almost exclusively in the nitration of acetanilide?
A:
Q: Provide a stepwise synthesis for benzyl chloride to benzoic acid.(including arrow-pushing…
A: We have to provide a stepwise synthesis for benzyl chloride to benzoic acid.(including arrow-pushing…
Q: Is phenol easier or more difficult to substitute with bromine than benzene?
A: Phenol is a derivative of benzene in which one of the hydrogen atom of the benzene ring is replaced…
Q: What is indicated by the result obtained in the reaction of acetanilide with bromine in acetic acid?…
A:
Q: What is needed to synthesize 2-methyl-benzophenone in a Friedel-Crafts acylation reaction.
A: Friedel-crafts acylation reaction of benzene or benzene substituents with acylium ion (RCO+) or…
Q: What happens when benzaldehyde reacts with sodium bisulfite? What happens when acetone reacts with…
A:
Q: Acid-base extraction :benzoic acid, p-nitroaniline and azobenzene in dichloromethane. 1.why is…
A: 1) Usually anhydrous sodium sulfate is used in the acid-base extraction as an inert drying agent.…
Q: What does a theoretical yield of 0.0488g and a percentage error of 3.6% mean in a Grignard synthesis…
A: Given: A theoretical yield of 0.0488 g and a percentage error of 3.6%.
Q: Explain the experimental procedure of the laboratory preparation of the synthesis of Aniline from…
A: Reaction Procedure:
Q: Show the reaction mechanisms in converting benzophenone to benzopinacol to benzopinacolone. Why must…
A: Benzophenone when reacted with isopropyl alcohol in presence of light forms benzopinacol.…
Q: why the acetylation requires one mole of acetic anhydride per mole of aniline, though acetic…
A: In the organic synthesis, suitable reagent converts the reactant into products. Reagents attacks…
Q: Why does phenol or aniline react with benzene diatonic chloride during a coupling reaction, but…
A:
Q: Comment on the pKa of picric acid and explain why it is so acidic compared to phenol.
A: Given acids are : a). Picric acid b). Phenol Why picric acid is more acidic than phenol = ?
Q: • What is indicated by the result obtained in the reaction of acetanilide with bromine in acetic…
A: This is the concept of Electrophilic substitution reaction.
Q: Why is benzene diazonium chloride not stored and is used immediately after its preparation?
A:
Q: why the –NHCOCH3 group in acetanilide is only moderately activating while the -NH2 group in aniline…
A: As per regulation only one question can be answered. Besides question 2 is incomplete.
Q: Can acetyl chloride be used in place of acetic anhydride in the synthesis of acetanilide with…
A: Synthesis of Acetanilide from acetyl chloride and aniline.
Q: How do you explain the difference in colors between the hydrazone product formed from simple…
A: we can identify carbonyl group of aldehydes or ketones by 2,4 DNP test. If compound give solid…
Q: Define what is reduction reaction, reducing agents, weak and strong reducing agents sodium…
A: Reduction reaction Reducing agent Weak reducing agent Strong reducing agent Reduction of…
Q: Why is the ether layer containing naphthalene washed with saturated sodium chloride after completely…
A: Given scenario is,, ether layer containing naphthalene washed with saturated sodium chloride after…
Q: From the lists of available reagents select the one(s) you would use to in a preparation of…
A: Grignard can change to the required product.
Q: two compounds of B and C, showed positive results with 2,4-dinitrophenylhydrazine. Compound B reacts…
A: We will find out molecule with the given observation
Q: Why is it easier to remove excess acetic acid from the products than excess isopentyl alcohol?
A: The given statement is, It is easier to remove excess acetic acid from the products than excess…
Why does phenol or aniline react with benzene diazonium chloride during a coupling reaction, but benzene does not?
Step by step
Solved in 2 steps with 1 images
- Give one reason why benzene can act as an acid in the following reaction,Give the sequence of the relative reactivities of carboxylic acid derivatives. Explain why acyl chloride can be converted into ester but ester cannot be converted into acyl chloride?What reactions and reagents can be used to make phenol from benzene if electrophilic aromatic substitution reactions are excluded and benzene is the only source of carbon?
- Explain the experimental procedure of the laboratory preparation of the synthesis of benzyl chloride from phenol Explain the chemistry behind the synthesis of benzyl chloride from phenolDibenzalpropanone is a compound that can absorb UV rays and can be used as a sunscreen. Write down the reagents used to synthesize the compound dibenzalpropanone.What reactions and reagents can be used to make phenol from benzene if electrophilid aromatic substitution reactions are excluded?
- What is the reaction mechanism for formaldehyde and phenol under acidic conditions.Which functional group has the maximum reactivity toward nucleophilic attack? a) acid chloride b) ketone c) ester d) amideThe analgesic Tylenol is often taken by people who are allergic to aspirin. Tylenol contains acetaminophen (structure shown) as the active ingredient. Is the structure of acetaminophen similar to the structure of aspirin? In what way? Would acetaminophen give a positive phenol test? What products would be obtained if acetaminophen were hydrolyzed in acidic aqueous solution?
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
