Answered: A reaction with an enthalpy of -16.9 kJ…

A reaction with an enthalpy of -16.9 kJ and and entropy of -265 J/K is being run at -115°C. What is the free energy of the reaction?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter16: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 60E

See similar textbooks

Related questions

Q: Draw the structure of the polymer which would form when the following molecules react. (draw two…

A: Step 1: Ste Step 3: Step 4:

Q: How many protons are in the Pb-208 isotope? 126 208 82 290

A: A. How many protons are in Pb-208 isotope?-Pb corresponds to element Lead(Pb).-Pb on the periodic…

Q: dont provide handwriting soliution ......

A: Step 1: given line segment with endpoint (-4, -1) and (0, -2) We have…

Q: Use this information to answer each question: A student constructs an electrochemical cell with a…

Q: None

A: In the ferrous ion, iron has lost two electrons compared to its neutral state (Fe). Iron's neutral…

Q: A mixture of 2 mL of 3 M NaOH solution, 2.5 mL 95% ethanol, 0.212 g benzaldehyde, and 0.058 g…

A: The reaction is the Aldol condensation, 2C6H5CHO+CH3COCH3→C6H5CH=CHC(O)CH=C6H5+2H2Owhere…

Q: Question 15

A: Step 1:

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: *Reaction is in image* Questions based on reaction in image: The oxidizing agent is: The reducing…

A: When one species loses the electrons increasing its oxidation number is called oxidized and the…

Q: Indicate how to synthesize 5-Methyl-3-hexanone from 1,3-dithiane.

A: The objective of this question is to outline a method for synthesizing 5-Methyl-3-hexanone from…

Q: Determine a reasonable synthetic scheme for a multi step synthesis using substitution, elimination,…

A: Approach to solving the question:In this scheme, an alkene is first given a halogen addition, then a…

Q: 1 THE SECOND LAW [6] Calculate the change in the entropies of the system and the surroundings, and…

A: Step 1: Step 2: Step 3: Step 4:

Q: No answer from Chat GPT please will downvote The hand written solution is not allowed.

A: The second law of thermodynamics, which states that the entropy of the universe tends to increase…

Q: A buret is cleaned and filled to the 0.85 ml mark with 0.123 M hydrochloric acid solution. Another…

A: Step 1:

Q: 1. Aldol reactions (condensation of two aldehydes or ketones to yield a ẞ-hydroxy carbonyl) can go…

A: MECHANISM :EXPLANATION: The Aldol reaction occurs in the first two step of the reaction. Enolate…

Q: Please don't provide handwritten solution ....

A: Step 1: The ring attached to NH group is more activated due to delocalisation of electrons. Step…

Q: Please answer chem

A: Step 1:Williamson synthesis follows SN2 reaction pathway. Step 2:In pathway A , nucleophile is…

Q: Draw the structure(s) of the major organic product(s), including counterions, of the following…

A: I can help you with this chemistry question which asks you to draw the structure of the major…

Q: None

A: The question is asking us to determine the nature of two cycloaddition reactions, specifically…

Q: A solution contains 0.127 M ammonium iodide and 0.112 M ammonia. The pH of this solution is

A: Step 1: Step 2: Step 3: Step 4:

Q: dont provide handwriting solution...

A: The objective of this question is to determine the amount of the reagent in excess that remains…

Q: Please don't provide handwritten solution ...

Q: what is the pka of 50.00mL of 0.12M NH3 and 3.50mL of 1.0M HCl

A: Step 1:To find the pKapKa of the resulting solution after mixing NH3 and HCl, we need to consider…

Q: Need help with the structures and major products

A: The starting materials has been shown here. Cyclopentanone reacts with pyrrolidine to form a enamine…

Q: Curved arrows are used to illustrate the flow of electrons. Using the provided starting and product…

A: Step 1: Hydroboration Oxidation of alkene: This is a method of hydration of alkene according to…

Q: solve step by step

A: .Step 1: From the given data we can calculate the melting point of ice at this condition using…

Q: Question 11 Propose best Williamson ether syntheses for the following compounds. Select all…

Q: Fill in the missing product

A: I can help you with the missing product in the chemical reaction.The aromatic ring in the reactant…

Q: I do not understand what is going on in the second and third portion of the mechansim, I am…

A: The CH3Li is an organolithium reagent that is used in carbon-carbon bond synthesis. In reactions…

Q: Draw a triacylglycerol with 12 carbon chains that are monounsaturated (you can choose the site of…

A: Step 1: Any unsaturated fatty acid's carbon-carbon double bonds can be converted to carbon-carbon…

Q: why CO2 are nonpolar bonds

A: The question is asking why the bonds in a carbon dioxide (CO2) molecule are nonpolar. To answer…

Q: Give a balanced reaction equation for the reaction between Ni(NH3)62+ and HCl

A: The reaction between Ni(NH3)62+ (hexaamminenickel(II) ion) and HCl (hydrochloric acid) involves…

Q: What volume of carbon dioxide (in L) will 2.14 g of antacid made of calcium carbonate produce at…

A: Given mass of calcium carbonate = 2.14 g Molar mass of calcium carbonate= 100. g/molNo. of moles of…

Q: 4. Use your answer to Q3 to predict the product(s) of your reaction if you had started with…

Q: Please give Step by Step Answer Otherwise i give DISLIKE !!

A: Step 1: Step 2: Step 3: Step 4:

Q: 3. The chemical equation for the decomposition of potassium chlorate is 2 KClO3(s) → 2 KCI(s) +…

A: To solve this problem, we first need to find the molar mass of potassium chlorate (KClO3) and then…

Q: Part 3 (3 pts each) 1) Write the balanced molecular, total ionic, and net ionic equation for the…

A: The objective of the question is to write the balanced molecular, total ionic, and net ionic…

Q: Reaction of Aldehydes and Ketones with Organometallics: Grignard and Lithium For the following…

A: Step 1: Step 2: Step 3: Step 4:

Q: Please don't upload any image just give me the answer with proper explanation

A: Approach to solving the question:Read alot of related books or research onlineDetailed…

Q: Consider the following cell line notation, Sn(s) | Sn2+(aq) | | Ag+(aq) | Ag(s) Does the redox…

A: So the answer is yes, the redox reaction have a spontaneous flow of electrons If you find this…

Q: Draw a bond that can be hydrolyzed by an endopeptidase. Include relevant atoms in your drawing.

A: Endopeptidase is one of the many enzymes in a living system and this enzyme catalyzes the hydrolysis…

Q: None

A: Understanding the chemical reaction depicted in the image involves an electrophilic addition of…

Q: What are the uses of NMR in new drug discoveries?

A: Uses of NMR in New Drug DiscoveriesStructure Determination: NMR spectroscopy is used to determine…

Q: A PB tablet containing 425 mg of BSS is combined with HCl. The solution is filtered, transferred to…

A: Step 1:

Q: A chemist carefully measures the amount of heat needed to raise the temperature of a 260.0 g sample…

A: To find the specific heat capacity (C) of the substance, we can use the formula:Q=m×C×ΔTwhere:- Q is…

Q: if 10.00 mL of standard Fe(NO3)3 is diluted to 50.00 mL with water the final molarity is

A: Given: Molarity of Standard Fe(NO3) = 5.00x10-2 M a.) To make a fixed amount of a dilute solution…

Q: Most common amines (RNH2) exhibit pKa values between 35 and 45. R represents the rest of the…

A: The presence of a cyano group (-CN) introduces significant electron withdrawal due to its strong…

Q: 3+ 2+ For the reaction 2Ga (aq) + 3Zn(s) → 2Ga(s) + 3Zn (aq)E° = 0.21V Determine the 3+ value of E °…

A: To determine the reduction potential (E°red) for the Ga3+/Ga half-cell from the given overall…

Q: 2 CHEMICAL POTENTIAL [6] Calculate the difference in slope of the chemical potential against…

Q: WS-3.3: Draw a detailed free energy diagram for the chlorination of benzene. Include and label the…

Question

dont provide handwriting solution.....

A reaction with an enthalpy of -16.9 kJ and and entropy of -265 J/K is being run
at -115°C. What is the free energy of the reaction?

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)
Consider the reaction Fe2O3(s)+3H2(g)2Fe(s)+3H2O(g) a. Use Gf values in Appendix 4 to calculate G for this reaction. b. Is this reaction spontaneous under standard conditions at 298 K? c. The value of H for this reaction is 100. kJ. At what temperatures is this reaction spontaneous at standard conditions? Assume that H and S do not depend on temperature.
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
Consider the reaction: H2S(g)+SO2(g)3S(g)+2H2O(l) for which H is 233 kJ and S is 424 J/K. a. Calculate the free energy change for the reaction (G) at 393 K. b. Assuming H and S do not depend on temperature, at what temperatures is this reaction spontaneous?
Hydrogen bums in air with considerable heat transfer to the surroundings. Consider the decomposition of water togaseous hydrogen and oxygen. Without doing any calculations, and basing your prediction on the enthalpychange and the entropy change, is this reaction product-favored at 25 C? Explain your answer briefly.
What information can be determined from G for a reaction? Does one get the same information from G, the standard free energy change? G allows determination of the equilibrium constant K for a reaction. How? How can one estimate the value of K at temperatures other than 25C for a reaction? How can one estimate the temperature where K = 1 for a reaction? Do all reactions have a specific temperature where K = 1?
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
Hydrogen has been suggested as the fuel of the future. One way to store it is to convert it to a compound that can be heated to release the hydrogen. One such compound is calcium hydride, Cal-12. This compound has a heat of formation of -186.2 kJ/mol and a standard entropy of 42.0 J/mol K. What is the minimum temperature to which calcium hydride would have to be heated to produce hydrogen at one atmosphere pressure?
Is the formation of ozone (O3(g)) from oxygen (O2(g)) spontaneous at room temperature under standard state conditions?
Use the standard free energy of formation data in Appendix G to determine the free energy change for each of the following reactions, which are run under standard state conditions and 25 C. Identify each as either spontaneous or nonspontaneous at these conditions. (a) MnO2(s)Mn(s)+O2(g) (b) H2(g)+Br2(l)2HBr(g) (c) Cu(s)+S(g)CuS(s) (d) 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) (e) CH4(g)+O2(g)C(s,graphite)+2H2O(g) (f) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
Using data from Appendix 4, calculate G for the reaction NO(g)+O3(g)NO2(g)+O2(g) for these conditions: T=298KPNO=1.00106atm,PO3=2.00106atmPNO2=1.00107atm,PO2=1.00103atm