Consider the half-reaction for the reduction of Cd²+ to Cd(s). Cd²+ (aq) + 2e → Cd(s) Ecd² d Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0760 M solution of CdBr₂. Ecd = Ecd= -0.4383 Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0520 M NaOH solution that is saturated with Cd(OH)2. The Ksp for Cd(OH)₂ is 7.2 x 10-¹5. Ecd = -0.4383 Incorrect Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0350 M Cd(NH3)2 + and 0.105 M NH² solution. The ß4 for Cd(NH3)²+is 3.63 × 106. = -0.403 V -0.4383 Incorrect V V V

Consider the half-reaction for the reduction of Cd²+ to Cd(s). Cd²+ (aq) + 2e → Cd(s) Ecd² d Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0760 M solution of CdBr₂. Ecd = Ecd= -0.4383 Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0520 M NaOH solution that is saturated with Cd(OH)2. The Ksp for Cd(OH)₂ is 7.2 x 10-¹5. Ecd = -0.4383 Incorrect Calculate the potential of the cadmium electrode at 25 °C when immersed in a 0.0350 M Cd(NH3)2 + and 0.105 M NH² solution. The ß4 for Cd(NH3)²+is 3.63 × 106. = -0.403 V -0.4383 Incorrect V V V

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 120AE

See similar textbooks

Similar questions

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.