Concept explainers
(a)
Interpretation:
The standard enthalpy change for the given “cracking” reaction has to be calculated
Concept Introduction:
Enthalpy of reaction: (
The enthalpy of a reaction is calculated by subtracting the heat of formation of reactatns from heat of formation of products.
(a)
Answer to Problem 21.123QP
The standard enthalpy change for the given “cracking” reaction is
Explanation of Solution
Given data:
The given cracking reaction is:
To Calculate: The standard enthalpy change for the given “cracking” reaction.
Using the Appendix C, the heat of formation (
The
Hence, the standard enthalpy change is
The standard enthalpy change for the given “cracking” reaction is calculated as
(b)
Interpretation:
The standard enthalpy change for the given “cracking” reaction has to be calculated
Concept Introduction:
Enthalpy of reaction: (
The enthalpy of a reaction is calculated by subtracting the heat of formation of reactatns from heat of formation of products.
(b)
Answer to Problem 21.123QP
The standard enthalpy change for the given “cracking” reaction is
Explanation of Solution
Given data:
The given cracking reaction is:
To Calculate: The standard enthalpy change for the given “cracking” reaction.
Using the Appendix C, the heat of formation (
The
Hence, the standard enthalpy change is
The standard enthalpy change for the given “cracking” reaction is calculated as
Want to see more full solutions like this?
Chapter 21 Solutions
General Chemistry - Standalone book (MindTap Course List)
- When lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardOne step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forward
- Although the gas used in an oxyacetylene torch (Figure 5.7) is essentially pure acetylene, the heat produced by combustion of one mole of acetylene in such a torch is likely not equal to the enthalpy of combustion of acetylene listed in Table 5.2. Considering the conditions for which the tabulated data are reported, suggest an explanation.arrow_forwardCalculate the enthalpy change when 1.0(1 g of methane is burned in excess oxygen according to the reaction CH,(g) 4- 2O2(g) ->CO2(g) + H-CH/) 1H = -891 kJ/molarrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- Given: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).arrow_forwardWe burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- Introductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningWorld of ChemistryChemistryISBN:9780618562763Author:Steven S. ZumdahlPublisher:Houghton Mifflin College DivChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax